C11H12IN3 — CID 58154293
3-(2-cyclopropylethyl)-8-iodo-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 58154293) has the molecular formula C11H12IN3 and a molecular weight of 313.14 g/mol. Its IUPAC name is 3-(2-cyclopropylethyl)-8-iodo-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(2-cyclopropylethyl)-8-iodo-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 58154293 |
| Molecular Formula | C11H12IN3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 3-(2-cyclopropylethyl)-8-iodo-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Ic1cccn2c(CCC3CC3)nnc12 |
| InChI | InChI=1S/C11H12IN3/c12-9-2-1-7-15-10(13-14-11(9)15)6-5-8-3-4-8/h1-2,7-8H,3-6H2 |
| InChIKey | OYWKBPCOPFTFCN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|