C33H48FN5O — CID 58154352
4-[[N-[(1S,2S,3S)-3-ethyl-2,4,4-trimethylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methylphenyl)ethyl]benzamide (PubChem CID 58154352) has the molecular formula C33H48FN5O and a molecular weight of 549.78 g/mol. Its IUPAC name is 4-[[N-[(1S,2S,3S)-3-ethyl-2,4,4-trimethylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methylphenyl)ethyl]benzamide.
| Compound Name | 4-[[N-[(1S,2S,3S)-3-ethyl-2,4,4-trimethylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 58154352 |
| Molecular Formula | C33H48FN5O |
| Molecular Weight | 549.78 g/mol |
| Exact Mass | 549.38 |
| IUPAC Name | 4-[[N-[(1S,2S,3S)-3-ethyl-2,4,4-trimethylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methylphenyl)ethyl]benzamide |
| SMILES | CC[C@H]1[C@H](C)[C@@H](/N=C(\Nc2ccc(C(=O)NCCc3ccc(C)cc3F)cc2)N2CCN[C@@H](C)C2)CCC1(C)C |
| InChI | InChI=1S/C33H48FN5O/c1-7-28-24(4)30(14-16-33(28,5)6)38-32(39-19-18-35-23(3)21-39)37-27-12-10-26(11-13-27)31(40)36-17-15-25-9-8-22(2)20-29(25)34/h8-13,20,23-24,28,30,35H,7,14-19,21H2,1-6H3,(H,36,40)(H,37,38)/t23-,24-,28-,30-/m0/s1 |
| InChIKey | HSPGETIYFXFPQI-MDQQPNHYSA-N |
| XLogP | 6.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.78 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|