C24H43N5 — CID 58154867
N'-(1H-imidazol-2-ylmethyl)-N,N-dipropyl-N'-(3H-pyrrol-2-ylmethyl)nonane-1,9-diamine (PubChem CID 58154867) has the molecular formula C24H43N5 and a molecular weight of 401.64 g/mol. Its IUPAC name is N'-(1H-imidazol-2-ylmethyl)-N,N-dipropyl-N'-(3H-pyrrol-2-ylmethyl)nonane-1,9-diamine.
| Compound Name | N'-(1H-imidazol-2-ylmethyl)-N,N-dipropyl-N'-(3H-pyrrol-2-ylmethyl)nonane-1,9-diamine |
|---|---|
| PubChem CID | 58154867 |
| Molecular Formula | C24H43N5 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | N'-(1H-imidazol-2-ylmethyl)-N,N-dipropyl-N'-(3H-pyrrol-2-ylmethyl)nonane-1,9-diamine |
| SMILES | CCCN(CCC)CCCCCCCCCN(CC1=NC=CC1)Cc1ncc[nH]1 |
| InChI | InChI=1S/C24H43N5/c1-3-17-28(18-4-2)19-10-8-6-5-7-9-11-20-29(21-23-13-12-14-25-23)22-24-26-15-16-27-24/h12,14-16H,3-11,13,17-22H2,1-2H3,(H,26,27) |
| InChIKey | RXCJTLGCRPKBMF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 47.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|