About 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane
8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 581554) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane |
| PubChem CID | 581554 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | CCCCC1CCC2(C1)OC(C)C(C)O2 |
| InChI | InChI=1S/C13H24O2/c1-4-5-6-12-7-8-13(9-12)14-10(2)11(3)15-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | RTSYSPMKCKIRRP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane?
The IUPAC name of 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane (CID 581554) is 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane.
What is the SMILES notation for 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane?
The canonical SMILES for 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane is CCCCC1CCC2(C1)OC(C)C(C)O2.
What is the InChIKey of 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane?
The InChIKey is RTSYSPMKCKIRRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-4-5-6-12-7-8-13(9-12)14-10(2)11(3)15-13/h10-12H,4-9H2,1-3H3.
What are the key properties of 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane?
8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane has a molecular weight of 212.33 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butyl-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane is sourced from PubChem (CID 581554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).