About 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine
8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine (PubChem CID 58155511) has the molecular formula C23H21F3N6
and a molecular weight of 438.46 g/mol. Its IUPAC name is 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine.
Molecular Properties
| Compound Name | 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine |
| PubChem CID | 58155511 |
| Molecular Formula | C23H21F3N6 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine |
| SMILES | Fc1ccccc1CNc1ncc2nc(-c3cccc(F)c3F)n(C3CCNCC3)c2n1 |
| InChI | InChI=1S/C23H21F3N6/c24-17-6-2-1-4-14(17)12-28-23-29-13-19-22(31-23)32(15-8-10-27-11-9-15)21(30-19)16-5-3-7-18(25)20(16)26/h1-7,13,15,27H,8-12H2,(H,28,29,31) |
| InChIKey | BRBFNUKHHVNGTR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine?
The IUPAC name of 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine (CID 58155511) is 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine.
What is the SMILES notation for 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine?
The canonical SMILES for 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine is Fc1ccccc1CNc1ncc2nc(-c3cccc(F)c3F)n(C3CCNCC3)c2n1.
What is the InChIKey of 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine?
The InChIKey is BRBFNUKHHVNGTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F3N6/c24-17-6-2-1-4-14(17)12-28-23-29-13-19-22(31-23)32(15-8-10-27-11-9-15)21(30-19)16-5-3-7-18(25)20(16)26/h1-7,13,15,27H,8-12H2,(H,28,29,31).
What are the key properties of 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine?
8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine has a molecular weight of 438.46 g/mol, XLogP of 4.45, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,3-difluorophenyl)-N-[(2-fluorophenyl)methyl]-9-piperidin-4-ylpurin-2-amine is sourced from PubChem (CID 58155511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).