C26H26N2O4S — CID 58156101
[4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] methanesulfonate (PubChem CID 58156101) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is [4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] methanesulfonate.
| Compound Name | [4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] methanesulfonate |
|---|---|
| PubChem CID | 58156101 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] methanesulfonate |
| SMILES | Cc1ccc(CC(=O)c2ccc3nc(-c4c(C)cc(OS(C)(=O)=O)cc4C)[nH]c3c2)cc1C |
| InChI | InChI=1S/C26H26N2O4S/c1-15-6-7-19(10-16(15)2)13-24(29)20-8-9-22-23(14-20)28-26(27-22)25-17(3)11-21(12-18(25)4)32-33(5,30)31/h6-12,14H,13H2,1-5H3,(H,27,28) |
| InChIKey | ANBHZTSUCSAWTA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|