C26H23N3O4S2 — CID 58156134
[3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] methanesulfonate (PubChem CID 58156134) has the molecular formula C26H23N3O4S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is [3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] methanesulfonate.
| Compound Name | [3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 58156134 |
| Molecular Formula | C26H23N3O4S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | [3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] methanesulfonate |
| SMILES | Cc1nc2cc(CC(=O)c3ccc4nc(-c5c(C)cc(OS(C)(=O)=O)cc5C)[nH]c4c3)ccc2s1 |
| InChI | InChI=1S/C26H23N3O4S2/c1-14-9-19(33-35(4,31)32)10-15(2)25(14)26-28-20-7-6-18(13-21(20)29-26)23(30)12-17-5-8-24-22(11-17)27-16(3)34-24/h5-11,13H,12H2,1-4H3,(H,28,29) |
| InChIKey | SDKSPSKALXEXMH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|