C32H27N3O4S2 — CID 58156177
[3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 58156177) has the molecular formula C32H27N3O4S2 and a molecular weight of 581.72 g/mol. Its IUPAC name is [3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58156177 |
| Molecular Formula | C32H27N3O4S2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | [3,5-dimethyl-4-[6-[2-(2-methyl-1,3-benzothiazol-5-yl)acetyl]-1H-benzimidazol-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(C)c(-c3nc4ccc(C(=O)Cc5ccc6sc(C)nc6c5)cc4[nH]3)c(C)c2)cc1 |
| InChI | InChI=1S/C32H27N3O4S2/c1-18-5-9-25(10-6-18)41(37,38)39-24-13-19(2)31(20(3)14-24)32-34-26-11-8-23(17-27(26)35-32)29(36)16-22-7-12-30-28(15-22)33-21(4)40-30/h5-15,17H,16H2,1-4H3,(H,34,35) |
| InChIKey | QVCDHEFKVATRNW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|