C26H23F3N2O4S — CID 58156301
[4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate (PubChem CID 58156301) has the molecular formula C26H23F3N2O4S and a molecular weight of 516.54 g/mol. Its IUPAC name is [4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58156301 |
| Molecular Formula | C26H23F3N2O4S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | [4-[6-[2-(3,4-dimethylphenyl)acetyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(CC(=O)c2ccc3nc(-c4c(C)cc(OS(=O)(=O)C(F)(F)F)cc4C)[nH]c3c2)cc1C |
| InChI | InChI=1S/C26H23F3N2O4S/c1-14-5-6-18(9-15(14)2)12-23(32)19-7-8-21-22(13-19)31-25(30-21)24-16(3)10-20(11-17(24)4)35-36(33,34)26(27,28)29/h5-11,13H,12H2,1-4H3,(H,30,31) |
| InChIKey | LBAJBHACEHIZHX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|