About 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine
3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine (PubChem CID 581565) has the molecular formula C13H10Cl3NOS
and a molecular weight of 334.66 g/mol. Its IUPAC name is 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine.
Molecular Properties
| Compound Name | 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine |
| PubChem CID | 581565 |
| Molecular Formula | C13H10Cl3NOS |
| Molecular Weight | 334.66 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine |
| SMILES | Cc1nc(C)c(Cl)c(S(=O)c2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C13H10Cl3NOS/c1-7-11(15)13(12(16)8(2)17-7)19(18)10-5-3-9(14)4-6-10/h3-6H,1-2H3 |
| InChIKey | HZWKLHOAUKAOES-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine?
The IUPAC name of 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine (CID 581565) is 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine.
What is the SMILES notation for 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine?
The canonical SMILES for 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine is Cc1nc(C)c(Cl)c(S(=O)c2ccc(Cl)cc2)c1Cl.
What is the InChIKey of 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine?
The InChIKey is HZWKLHOAUKAOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl3NOS/c1-7-11(15)13(12(16)8(2)17-7)19(18)10-5-3-9(14)4-6-10/h3-6H,1-2H3.
What are the key properties of 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine?
3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine has a molecular weight of 334.66 g/mol, XLogP of 4.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-(4-chlorophenyl)sulfinyl-2,6-dimethylpyridine is sourced from PubChem (CID 581565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).