About 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline
5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 58157202) has the molecular formula C11H13Cl2N
and a molecular weight of 230.14 g/mol. Its IUPAC name is 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 58157202 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCN1CCc2c(Cl)cc(Cl)cc2C1 |
| InChI | InChI=1S/C11H13Cl2N/c1-2-14-4-3-10-8(7-14)5-9(12)6-11(10)13/h5-6H,2-4,7H2,1H3 |
| InChIKey | GNKNDELKBASVDM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline (CID 58157202) is 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline is CCN1CCc2c(Cl)cc(Cl)cc2C1.
What is the InChIKey of 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is GNKNDELKBASVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2N/c1-2-14-4-3-10-8(7-14)5-9(12)6-11(10)13/h5-6H,2-4,7H2,1H3.
What are the key properties of 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline?
5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 230.14 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2-ethyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 58157202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).