C20H24N6O2S — CID 58157296
4-(benzenesulfonyl)-11-methyl-5-piperazin-1-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene (PubChem CID 58157296) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-11-methyl-5-piperazin-1-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene.
| Compound Name | 4-(benzenesulfonyl)-11-methyl-5-piperazin-1-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 58157296 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-(benzenesulfonyl)-11-methyl-5-piperazin-1-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
| SMILES | CN1CCc2nc3c(S(=O)(=O)c4ccccc4)c(N4CCNCC4)nn3cc2C1 |
| InChI | InChI=1S/C20H24N6O2S/c1-24-10-7-17-15(13-24)14-26-19(22-17)18(20(23-26)25-11-8-21-9-12-25)29(27,28)16-5-3-2-4-6-16/h2-6,14,21H,7-13H2,1H3 |
| InChIKey | UBXCXDLXXKCDOQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |