About 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane
2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane (PubChem CID 58157342) has the molecular formula C11H18Br2
and a molecular weight of 310.07 g/mol. Its IUPAC name is 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane |
| PubChem CID | 58157342 |
| Molecular Formula | C11H18Br2 |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane |
| SMILES | CC(C)(C)C1C(C=C(Br)Br)C1(C)C |
| InChI | InChI=1S/C11H18Br2/c1-10(2,3)9-7(6-8(12)13)11(9,4)5/h6-7,9H,1-5H3 |
| InChIKey | JCFGXXIOSHETDZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
The IUPAC name of 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane (CID 58157342) is 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane.
What is the SMILES notation for 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
The canonical SMILES for 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane is CC(C)(C)C1C(C=C(Br)Br)C1(C)C.
What is the InChIKey of 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
The InChIKey is JCFGXXIOSHETDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18Br2/c1-10(2,3)9-7(6-8(12)13)11(9,4)5/h6-7,9H,1-5H3.
What are the key properties of 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane has a molecular weight of 310.07 g/mol, XLogP of 4.94, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 58157342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).