C10H15F3N2 — CID 58157486
3-tert-butyl-5-methyl-1-(2,2,2-trifluoroethyl)pyrazole (PubChem CID 58157486) has the molecular formula C10H15F3N2 and a molecular weight of 220.24 g/mol. Its IUPAC name is 3-tert-butyl-5-methyl-1-(2,2,2-trifluoroethyl)pyrazole.
| Compound Name | 3-tert-butyl-5-methyl-1-(2,2,2-trifluoroethyl)pyrazole |
|---|---|
| PubChem CID | 58157486 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-tert-butyl-5-methyl-1-(2,2,2-trifluoroethyl)pyrazole |
| SMILES | Cc1cc(C(C)(C)C)nn1CC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2/c1-7-5-8(9(2,3)4)14-15(7)6-10(11,12)13/h5H,6H2,1-4H3 |
| InChIKey | LFSKPFPBGZYPDO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |