About methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate
methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate (PubChem CID 58157649) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate.
Analyze methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate?
The IUPAC name of methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate (CID 58157649) is methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate.
What is the SMILES notation for methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate?
The canonical SMILES for methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate is COC(=O)c1cc2c(s1)CNCC2.
What is the InChIKey of methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate?
The InChIKey is ZBFJJGBWKCYVDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-12-9(11)7-4-6-2-3-10-5-8(6)13-7/h4,10H,2-3,5H2,1H3.
What are the key properties of methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate?
methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate has a molecular weight of 197.26 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate is sourced from PubChem (CID 58157649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).