About N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide
N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide (PubChem CID 58158665) has the molecular formula C17H27N5O2S
and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide.
Molecular Properties
| Compound Name | N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide |
| PubChem CID | 58158665 |
| Molecular Formula | C17H27N5O2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide |
| SMILES | CC/N=C(\NS(=O)(=O)c1cccc(CN)c1)N1CC2(CCCC2)CN1 |
| InChI | InChI=1S/C17H27N5O2S/c1-2-19-16(22-13-17(12-20-22)8-3-4-9-17)21-25(23,24)15-7-5-6-14(10-15)11-18/h5-7,10,20H,2-4,8-9,11-13,18H2,1H3,(H,19,21) |
| InChIKey | OYXWXHKKTNBFQV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide?
The IUPAC name of N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide (CID 58158665) is N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide.
What is the SMILES notation for N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide?
The canonical SMILES for N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide is CC/N=C(\NS(=O)(=O)c1cccc(CN)c1)N1CC2(CCCC2)CN1.
What is the InChIKey of N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide?
The InChIKey is OYXWXHKKTNBFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N5O2S/c1-2-19-16(22-13-17(12-20-22)8-3-4-9-17)21-25(23,24)15-7-5-6-14(10-15)11-18/h5-7,10,20H,2-4,8-9,11-13,18H2,1H3,(H,19,21).
What are the key properties of N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide?
N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide has a molecular weight of 365.50 g/mol, XLogP of 1.18, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(aminomethyl)phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]nonane-3-carboximidamide is sourced from PubChem (CID 58158665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).