C33H42N4O3SSi — CID 58158698
N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide (PubChem CID 58158698) has the molecular formula C33H42N4O3SSi and a molecular weight of 602.88 g/mol. Its IUPAC name is N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide.
| Compound Name | N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide |
|---|---|
| PubChem CID | 58158698 |
| Molecular Formula | C33H42N4O3SSi |
| Molecular Weight | 602.88 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide |
| SMILES | CC/N=C(\NS(=O)(=O)c1ccc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1)N1CC2(C=N1)CCCC2 |
| InChI | InChI=1S/C33H42N4O3SSi/c1-5-34-31(37-26-33(25-35-37)22-12-13-23-33)36-41(38,39)28-20-18-27(19-21-28)24-40-42(32(2,3)4,29-14-8-6-9-15-29)30-16-10-7-11-17-30/h6-11,14-21,25H,5,12-13,22-24,26H2,1-4H3,(H,34,36) |
| InChIKey | WBVASUOIMPNTMU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|