C25H26N2O5S — CID 58159068
2-[(4-aminophenyl)sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid (PubChem CID 58159068) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[(4-aminophenyl)sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid.
| Compound Name | 2-[(4-aminophenyl)sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 58159068 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[(4-aminophenyl)sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid |
| SMILES | C=CC[C@@H]1OC(c2cccc3ccccc23)C[C@@H]1C(NS(=O)(=O)c1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C25H26N2O5S/c1-2-6-22-21(15-23(32-22)20-10-5-8-16-7-3-4-9-19(16)20)24(25(28)29)27-33(30,31)18-13-11-17(26)12-14-18/h2-5,7-14,21-24,27H,1,6,15,26H2,(H,28,29)/t21-,22-,23?,24?/m0/s1 |
| InChIKey | FSWCSOHGRIOXIO-WOLZVPSQSA-N |
| XLogP | 3.88 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|