C27H29NO6S — CID 58159079
2-[[4-(methoxymethyl)phenyl]sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid (PubChem CID 58159079) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-[[4-(methoxymethyl)phenyl]sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid.
| Compound Name | 2-[[4-(methoxymethyl)phenyl]sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 58159079 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-[[4-(methoxymethyl)phenyl]sulfonylamino]-2-[(2S,3R)-5-naphthalen-1-yl-2-prop-2-enyloxolan-3-yl]acetic acid |
| SMILES | C=CC[C@@H]1OC(c2cccc3ccccc23)C[C@@H]1C(NS(=O)(=O)c1ccc(COC)cc1)C(=O)O |
| InChI | InChI=1S/C27H29NO6S/c1-3-7-24-23(16-25(34-24)22-11-6-9-19-8-4-5-10-21(19)22)26(27(29)30)28-35(31,32)20-14-12-18(13-15-20)17-33-2/h3-6,8-15,23-26,28H,1,7,16-17H2,2H3,(H,29,30)/t23-,24-,25?,26?/m0/s1 |
| InChIKey | SFLTWJQKTFTSLR-ZCCOPBOASA-N |
| XLogP | 4.44 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|