About methanesulfinate;methanethiolate;rutherfordium
methanesulfinate;methanethiolate;rutherfordium (PubChem CID 58159180) has the molecular formula C2H6O2RfS2-2
and a molecular weight of 393.20 g/mol. Its IUPAC name is methanesulfinate;methanethiolate;rutherfordium.
Molecular Properties
| Compound Name | methanesulfinate;methanethiolate;rutherfordium |
| PubChem CID | 58159180 |
| Molecular Formula | C2H6O2RfS2-2 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | methanesulfinate;methanethiolate;rutherfordium |
| SMILES | CS(=O)[O-].C[S-].[Rf] |
| InChI | InChI=1S/CH4O2S.CH4S.Rf/c1-4(2)3;1-2;/h1H3,(H,2,3);2H,1H3;/p-2 |
| InChIKey | YNSSHQCVCBGNAU-UHFFFAOYSA-L |
| XLogP | -0.34 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze methanesulfinate;methanethiolate;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfinate;methanethiolate;rutherfordium?
The IUPAC name of methanesulfinate;methanethiolate;rutherfordium (CID 58159180) is methanesulfinate;methanethiolate;rutherfordium.
What is the SMILES notation for methanesulfinate;methanethiolate;rutherfordium?
The canonical SMILES for methanesulfinate;methanethiolate;rutherfordium is CS(=O)[O-].C[S-].[Rf].
What is the InChIKey of methanesulfinate;methanethiolate;rutherfordium?
The InChIKey is YNSSHQCVCBGNAU-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4O2S.CH4S.Rf/c1-4(2)3;1-2;/h1H3,(H,2,3);2H,1H3;/p-2.
What are the key properties of methanesulfinate;methanethiolate;rutherfordium?
methanesulfinate;methanethiolate;rutherfordium has a molecular weight of 393.20 g/mol, XLogP of -0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfinate;methanethiolate;rutherfordium is sourced from PubChem (CID 58159180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).