C9H5F7 — CID 581593
1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene (PubChem CID 581593) has the molecular formula C9H5F7 and a molecular weight of 246.13 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene.
| Compound Name | 1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene |
|---|---|
| PubChem CID | 581593 |
| Molecular Formula | C9H5F7 |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene |
| SMILES | FC(F)(F)C(F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H5F7/c10-7(8(11,12)13,9(14,15)16)6-4-2-1-3-5-6/h1-5H |
| InChIKey | CHPJUEBSVFTIRX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |