About 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole
2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole (PubChem CID 58159479) has the molecular formula C22H19N3
and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole.
Molecular Properties
| Compound Name | 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole |
| PubChem CID | 58159479 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole |
| SMILES | c1ccc(CN2Cc3[nH]c4ccc(-c5cccnc5)cc4c3C2)cc1 |
| InChI | InChI=1S/C22H19N3/c1-2-5-16(6-3-1)13-25-14-20-19-11-17(18-7-4-10-23-12-18)8-9-21(19)24-22(20)15-25/h1-12,24H,13-15H2 |
| InChIKey | YLTKIKZLVWGXOY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole?
The IUPAC name of 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole (CID 58159479) is 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole.
What is the SMILES notation for 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole?
The canonical SMILES for 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole is c1ccc(CN2Cc3[nH]c4ccc(-c5cccnc5)cc4c3C2)cc1.
What is the InChIKey of 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole?
The InChIKey is YLTKIKZLVWGXOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3/c1-2-5-16(6-3-1)13-25-14-20-19-11-17(18-7-4-10-23-12-18)8-9-21(19)24-22(20)15-25/h1-12,24H,13-15H2.
What are the key properties of 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole?
2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole has a molecular weight of 325.42 g/mol, XLogP of 4.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-7-pyridin-3-yl-3,4-dihydro-1H-pyrrolo[3,4-b]indole is sourced from PubChem (CID 58159479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).