C19H20N2 — CID 58159616
4-benzyl-2,7-dimethyl-1,3-dihydropyrrolo[3,4-b]indole (PubChem CID 58159616) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-benzyl-2,7-dimethyl-1,3-dihydropyrrolo[3,4-b]indole.
| Compound Name | 4-benzyl-2,7-dimethyl-1,3-dihydropyrrolo[3,4-b]indole |
|---|---|
| PubChem CID | 58159616 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-benzyl-2,7-dimethyl-1,3-dihydropyrrolo[3,4-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2Cc2ccccc2)CN(C)C1 |
| InChI | InChI=1S/C19H20N2/c1-14-8-9-18-16(10-14)17-12-20(2)13-19(17)21(18)11-15-6-4-3-5-7-15/h3-10H,11-13H2,1-2H3 |
| InChIKey | KSOZWHFWMLZXMA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|