About [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate
[4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate (PubChem CID 58159758) has the molecular formula C18H14F3NO3S
and a molecular weight of 381.38 g/mol. Its IUPAC name is [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate |
| PubChem CID | 58159758 |
| Molecular Formula | C18H14F3NO3S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)cc(-c2cc(OS(=O)(=O)C(F)(F)F)nc3ccccc23)c1 |
| InChI | InChI=1S/C18H14F3NO3S/c1-11-7-12(2)9-13(8-11)15-10-17(25-26(23,24)18(19,20)21)22-16-6-4-3-5-14(15)16/h3-10H,1-2H3 |
| InChIKey | WESFJUMVGFGROZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate?
The IUPAC name of [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate (CID 58159758) is [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate is Cc1cc(C)cc(-c2cc(OS(=O)(=O)C(F)(F)F)nc3ccccc23)c1.
What is the InChIKey of [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate?
The InChIKey is WESFJUMVGFGROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3NO3S/c1-11-7-12(2)9-13(8-11)15-10-17(25-26(23,24)18(19,20)21)22-16-6-4-3-5-14(15)16/h3-10H,1-2H3.
What are the key properties of [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate?
[4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate has a molecular weight of 381.38 g/mol, XLogP of 4.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dimethylphenyl)quinolin-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 58159758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).