C26H20BNS3 — CID 58160060
7-(4-methylphenyl)-8,9,9-trithiophen-2-yl-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5,7-tetraene (PubChem CID 58160060) has the molecular formula C26H20BNS3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 7-(4-methylphenyl)-8,9,9-trithiophen-2-yl-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5,7-tetraene.
| Compound Name | 7-(4-methylphenyl)-8,9,9-trithiophen-2-yl-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 58160060 |
| Molecular Formula | C26H20BNS3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 7-(4-methylphenyl)-8,9,9-trithiophen-2-yl-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5,7-tetraene |
| SMILES | Cc1ccc(C2=C(c3cccs3)[B-](c3cccs3)(c3cccs3)[n+]3ccccc32)cc1 |
| InChI | InChI=1S/C26H20BNS3/c1-19-11-13-20(14-12-19)25-21-7-2-3-15-28(21)27(23-9-5-17-30-23,24-10-6-18-31-24)26(25)22-8-4-16-29-22/h2-18H,1H3 |
| InChIKey | JOMDDZWQLPAANW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|