C17H30O2 — CID 58160456
(4R,5S)-4-[(Z,2R,5S)-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane (PubChem CID 58160456) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (4R,5S)-4-[(Z,2R,5S)-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[(Z,2R,5S)-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane |
|---|---|
| PubChem CID | 58160456 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (4R,5S)-4-[(Z,2R,5S)-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@@H]1[C@H](C)/C=C\[C@@H](C)C(C)C |
| InChI | InChI=1S/C17H30O2/c1-8-9-15-16(19-17(6,7)18-15)14(5)11-10-13(4)12(2)3/h8,10-16H,1,9H2,2-7H3/b11-10-/t13-,14-,15+,16-/m1/s1 |
| InChIKey | ZPZKSBJIEZLGBW-ICVFZWBYSA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|