About 3-N,3-N-dimethylpropanediimidamide
3-N,3-N-dimethylpropanediimidamide (PubChem CID 58160656) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is 3-N,3-N-dimethylpropanediimidamide.
Molecular Properties
| Compound Name | 3-N,3-N-dimethylpropanediimidamide |
| PubChem CID | 58160656 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 3-N,3-N-dimethylpropanediimidamide |
| SMILES | [H]/N=C(\N)C/C(=N/[H])N(C)C |
| InChI | InChI=1S/C5H12N4/c1-9(2)5(8)3-4(6)7/h8H,3H2,1-2H3,(H3,6,7)/b8-5- |
| InChIKey | NFSLVSYMZVSPMX-YVMONPNESA-N |
| XLogP | -0.15 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-N,3-N-dimethylpropanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethylpropanediimidamide?
The IUPAC name of 3-N,3-N-dimethylpropanediimidamide (CID 58160656) is 3-N,3-N-dimethylpropanediimidamide.
What is the SMILES notation for 3-N,3-N-dimethylpropanediimidamide?
The canonical SMILES for 3-N,3-N-dimethylpropanediimidamide is [H]/N=C(\N)C/C(=N/[H])N(C)C.
What is the InChIKey of 3-N,3-N-dimethylpropanediimidamide?
The InChIKey is NFSLVSYMZVSPMX-YVMONPNESA-N. The full InChI is InChI=1S/C5H12N4/c1-9(2)5(8)3-4(6)7/h8H,3H2,1-2H3,(H3,6,7)/b8-5-.
What are the key properties of 3-N,3-N-dimethylpropanediimidamide?
3-N,3-N-dimethylpropanediimidamide has a molecular weight of 128.18 g/mol, XLogP of -0.15, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethylpropanediimidamide is sourced from PubChem (CID 58160656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).