About 1,8a-dihydroquinolin-8-ol
1,8a-dihydroquinolin-8-ol (PubChem CID 58161039) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1,8a-dihydroquinolin-8-ol.
Molecular Properties
| Compound Name | 1,8a-dihydroquinolin-8-ol |
| PubChem CID | 58161039 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1,8a-dihydroquinolin-8-ol |
| SMILES | OC1=CC=CC2=CC=CNC12 |
| InChI | InChI=1S/C9H9NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,9-11H |
| InChIKey | UGTQKCSZUNHSSE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8a-dihydroquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8a-dihydroquinolin-8-ol?
The IUPAC name of 1,8a-dihydroquinolin-8-ol (CID 58161039) is 1,8a-dihydroquinolin-8-ol.
What is the SMILES notation for 1,8a-dihydroquinolin-8-ol?
The canonical SMILES for 1,8a-dihydroquinolin-8-ol is OC1=CC=CC2=CC=CNC12.
What is the InChIKey of 1,8a-dihydroquinolin-8-ol?
The InChIKey is UGTQKCSZUNHSSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,9-11H.
What are the key properties of 1,8a-dihydroquinolin-8-ol?
1,8a-dihydroquinolin-8-ol has a molecular weight of 147.18 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8a-dihydroquinolin-8-ol is sourced from PubChem (CID 58161039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).