C90H60N4 — CID 58161407
4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)-N,N-bis[4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)phenyl]aniline (PubChem CID 58161407) has the molecular formula C90H60N4 and a molecular weight of 1197.50 g/mol. Its IUPAC name is 4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)-N,N-bis[4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)phenyl]aniline.
| Compound Name | 4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)-N,N-bis[4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)phenyl]aniline |
|---|---|
| PubChem CID | 58161407 |
| Molecular Formula | C90H60N4 |
| Molecular Weight | 1197.50 g/mol |
| Exact Mass | 1196.48 |
| IUPAC Name | 4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)-N,N-bis[4-(2,3-diphenyl-1H-benzo[g]indol-5-yl)phenyl]aniline |
| SMILES | c1ccc(-c2[nH]c3c(cc(-c4ccc(N(c5ccc(-c6cc7c(-c8ccccc8)c(-c8ccccc8)[nH]c7c7ccccc67)cc5)c5ccc(-c6cc7c(-c8ccccc8)c(-c8ccccc8)[nH]c7c7ccccc67)cc5)cc4)c4ccccc43)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C90H60N4/c1-7-25-61(26-8-1)82-79-55-76(70-37-19-22-40-73(70)88(79)91-85(82)64-31-13-4-14-32-64)58-43-49-67(50-44-58)94(68-51-45-59(46-52-68)77-56-80-83(62-27-9-2-10-28-62)86(65-33-15-5-16-34-65)92-89(80)74-41-23-20-38-71(74)77)69-53-47-60(48-54-69)78-57-81-84(63-29-11-3-12-30-63)87(66-35-17-6-18-36-66)93-90(81)75-42-24-21-39-72(75)78/h1-57,91-93H |
| InChIKey | KSRUBEIMANWPEV-UHFFFAOYSA-N |
| XLogP | 25.06 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1197.50 |
| LogP ≤ 5 | 25.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |