About 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline
5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline (PubChem CID 58161744) has the molecular formula C33H21F3N2
and a molecular weight of 502.54 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline.
Molecular Properties
| Compound Name | 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline |
| PubChem CID | 58161744 |
| Molecular Formula | C33H21F3N2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(F)cc3F)c3nc(-c4ccccc4)c(-c4ccccc4)nc23)c(F)c1 |
| InChI | InChI=1S/C33H21F3N2/c1-20-12-14-24(28(35)18-20)26-16-17-27(25-15-13-23(34)19-29(25)36)33-32(26)37-30(21-8-4-2-5-9-21)31(38-33)22-10-6-3-7-11-22/h2-19H,1H3 |
| InChIKey | OLWXQEIEUZNJRF-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline?
The IUPAC name of 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline (CID 58161744) is 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline.
What is the SMILES notation for 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline?
The canonical SMILES for 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline is Cc1ccc(-c2ccc(-c3ccc(F)cc3F)c3nc(-c4ccccc4)c(-c4ccccc4)nc23)c(F)c1.
What is the InChIKey of 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline?
The InChIKey is OLWXQEIEUZNJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H21F3N2/c1-20-12-14-24(28(35)18-20)26-16-17-27(25-15-13-23(34)19-29(25)36)33-32(26)37-30(21-8-4-2-5-9-21)31(38-33)22-10-6-3-7-11-22/h2-19H,1H3.
What are the key properties of 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline?
5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline has a molecular weight of 502.54 g/mol, XLogP of 9.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluorophenyl)-8-(2-fluoro-4-methylphenyl)-2,3-diphenylquinoxaline is sourced from PubChem (CID 58161744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).