About 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline
5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline (PubChem CID 58161746) has the molecular formula C32H18F4N2
and a molecular weight of 506.50 g/mol. Its IUPAC name is 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline.
Molecular Properties
| Compound Name | 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline |
| PubChem CID | 58161746 |
| Molecular Formula | C32H18F4N2 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline |
| SMILES | Fc1ccc(-c2ccc(-c3ccc(F)cc3F)c3nc(-c4ccccc4)c(-c4ccccc4)nc23)c(F)c1 |
| InChI | InChI=1S/C32H18F4N2/c33-21-11-13-23(27(35)17-21)25-15-16-26(24-14-12-22(34)18-28(24)36)32-31(25)37-29(19-7-3-1-4-8-19)30(38-32)20-9-5-2-6-10-20/h1-18H |
| InChIKey | FPAXPENBPQZKJV-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline?
The IUPAC name of 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline (CID 58161746) is 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline.
What is the SMILES notation for 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline?
The canonical SMILES for 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline is Fc1ccc(-c2ccc(-c3ccc(F)cc3F)c3nc(-c4ccccc4)c(-c4ccccc4)nc23)c(F)c1.
What is the InChIKey of 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline?
The InChIKey is FPAXPENBPQZKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H18F4N2/c33-21-11-13-23(27(35)17-21)25-15-16-26(24-14-12-22(34)18-28(24)36)32-31(25)37-29(19-7-3-1-4-8-19)30(38-32)20-9-5-2-6-10-20/h1-18H.
What are the key properties of 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline?
5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline has a molecular weight of 506.50 g/mol, XLogP of 8.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-bis(2,4-difluorophenyl)-2,3-diphenylquinoxaline is sourced from PubChem (CID 58161746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).