About 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline
5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline (PubChem CID 58161751) has the molecular formula C30H16F4N4
and a molecular weight of 508.48 g/mol. Its IUPAC name is 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline.
Molecular Properties
| Compound Name | 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline |
| PubChem CID | 58161751 |
| Molecular Formula | C30H16F4N4 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline |
| SMILES | Fc1ccc(-c2ccc(-c3ccc(F)cc3F)c3nc(-c4ccccn4)c(-c4ccccn4)nc23)c(F)c1 |
| InChI | InChI=1S/C30H16F4N4/c31-17-7-9-19(23(33)15-17)21-11-12-22(20-10-8-18(32)16-24(20)34)28-27(21)37-29(25-5-1-3-13-35-25)30(38-28)26-6-2-4-14-36-26/h1-16H |
| InChIKey | QKRPEQUFHRXROP-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline?
The IUPAC name of 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline (CID 58161751) is 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline.
What is the SMILES notation for 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline?
The canonical SMILES for 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline is Fc1ccc(-c2ccc(-c3ccc(F)cc3F)c3nc(-c4ccccn4)c(-c4ccccn4)nc23)c(F)c1.
What is the InChIKey of 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline?
The InChIKey is QKRPEQUFHRXROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H16F4N4/c31-17-7-9-19(23(33)15-17)21-11-12-22(20-10-8-18(32)16-24(20)34)28-27(21)37-29(25-5-1-3-13-35-25)30(38-28)26-6-2-4-14-36-26/h1-16H.
What are the key properties of 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline?
5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline has a molecular weight of 508.48 g/mol, XLogP of 7.64, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-bis(2,4-difluorophenyl)-2,3-dipyridin-2-ylquinoxaline is sourced from PubChem (CID 58161751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).