C31H41F3N6Pt — CID 58161815
4-(2,2-dimethylpropyl)-6-[2-[4-(2,2-dimethylpropyl)-6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(3-iminobut-1-enyl)pyridin-2-amine;platinum(2+) (PubChem CID 58161815) has the molecular formula C31H41F3N6Pt and a molecular weight of 749.78 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-6-[2-[4-(2,2-dimethylpropyl)-6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(3-iminobut-1-enyl)pyridin-2-amine;platinum(2+).
| Compound Name | 4-(2,2-dimethylpropyl)-6-[2-[4-(2,2-dimethylpropyl)-6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(3-iminobut-1-enyl)pyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 58161815 |
| Molecular Formula | C31H41F3N6Pt |
| Molecular Weight | 749.78 g/mol |
| Exact Mass | 749.30 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-6-[2-[4-(2,2-dimethylpropyl)-6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(3-iminobut-1-enyl)pyridin-2-amine;platinum(2+) |
| SMILES | [H]/N=C(C)/C=[C-]\Nc1cc(CC(C)(C)C)cc(C(C)(C)c2cc(CC(C)(C)C)cc(N/[C-]=C\C(=N/[H])C(F)(F)F)n2)n1.[Pt+2] |
| InChI | InChI=1S/C31H41F3N6.Pt/c1-20(35)10-12-37-26-16-21(18-28(2,3)4)14-24(39-26)30(8,9)25-15-22(19-29(5,6)7)17-27(40-25)38-13-11-23(36)31(32,33)34;/h10-11,14-17,35-36H,18-19H2,1-9H3,(H,37,39)(H,38,40);/q-2;+2/b35-20+,36-23+; |
| InChIKey | OQQMBUJPTUUJQU-CQROBQGLSA-N |
| XLogP | 8.06 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.78 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|