About dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane
dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane (PubChem CID 581620) has the molecular formula C12H26B2O3
and a molecular weight of 239.96 g/mol. Its IUPAC name is dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane.
Molecular Properties
| Compound Name | dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane |
| PubChem CID | 581620 |
| Molecular Formula | C12H26B2O3 |
| Molecular Weight | 239.96 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane |
| SMILES | CCCB(CCC)OCC1COB(CCC)O1 |
| InChI | InChI=1S/C12H26B2O3/c1-4-7-13(8-5-2)15-10-12-11-16-14(17-12)9-6-3/h12H,4-11H2,1-3H3 |
| InChIKey | MHOWTWDMTZYKJM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.96 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane?
The IUPAC name of dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane (CID 581620) is dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane.
What is the SMILES notation for dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane?
The canonical SMILES for dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane is CCCB(CCC)OCC1COB(CCC)O1.
What is the InChIKey of dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane?
The InChIKey is MHOWTWDMTZYKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26B2O3/c1-4-7-13(8-5-2)15-10-12-11-16-14(17-12)9-6-3/h12H,4-11H2,1-3H3.
What are the key properties of dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane?
dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane has a molecular weight of 239.96 g/mol, XLogP of 3.13, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl-[(2-propyl-1,3,2-dioxaborolan-4-yl)methoxy]borane is sourced from PubChem (CID 581620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).