About 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine
3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine (PubChem CID 58162175) has the molecular formula C14H14F2N2
and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine.
Molecular Properties
| Compound Name | 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine |
| PubChem CID | 58162175 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine |
| SMILES | CCC(C)c1ccnc(-c2ccc(F)nc2F)c1 |
| InChI | InChI=1S/C14H14F2N2/c1-3-9(2)10-6-7-17-12(8-10)11-4-5-13(15)18-14(11)16/h4-9H,3H2,1-2H3 |
| InChIKey | CLENCGQCIIRLJH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine?
The IUPAC name of 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine (CID 58162175) is 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine.
What is the SMILES notation for 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine?
The canonical SMILES for 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine is CCC(C)c1ccnc(-c2ccc(F)nc2F)c1.
What is the InChIKey of 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine?
The InChIKey is CLENCGQCIIRLJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2/c1-3-9(2)10-6-7-17-12(8-10)11-4-5-13(15)18-14(11)16/h4-9H,3H2,1-2H3.
What are the key properties of 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine?
3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine has a molecular weight of 248.28 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-butan-2-yl-2-pyridinyl)-2,6-difluoropyridine is sourced from PubChem (CID 58162175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).