About CID 58162444
CID 58162444 (PubChem CID 58162444) has the molecular formula C16H12IrN3-
and a molecular weight of 438.51 g/mol.
Molecular Properties
| Compound Name | CID 58162444 |
| PubChem CID | 58162444 |
| Molecular Formula | C16H12IrN3- |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | — |
| SMILES | Cc1cn2c3cccc(C)c3c3ncc[c-]c3c2n1.[Ir] |
| InChI | InChI=1S/C16H12N3.Ir/c1-10-5-3-7-13-14(10)15-12(6-4-8-17-15)16-18-11(2)9-19(13)16;/h3-5,7-9H,1-2H3;/q-1; |
| InChIKey | UFPBIRGTUPNKDZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 58162444 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58162444?
The IUPAC name of CID 58162444 (CID 58162444) is not available.
What is the SMILES notation for CID 58162444?
The canonical SMILES for CID 58162444 is Cc1cn2c3cccc(C)c3c3ncc[c-]c3c2n1.[Ir].
What is the InChIKey of CID 58162444?
The InChIKey is UFPBIRGTUPNKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N3.Ir/c1-10-5-3-7-13-14(10)15-12(6-4-8-17-15)16-18-11(2)9-19(13)16;/h3-5,7-9H,1-2H3;/q-1;.
What are the key properties of CID 58162444?
CID 58162444 has a molecular weight of 438.51 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58162444 is sourced from PubChem (CID 58162444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).