About 5,8-dimethylimidazo[1,2-f]phenanthridine
5,8-dimethylimidazo[1,2-f]phenanthridine (PubChem CID 58162818) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 5,8-dimethylimidazo[1,2-f]phenanthridine.
Molecular Properties
| Compound Name | 5,8-dimethylimidazo[1,2-f]phenanthridine |
| PubChem CID | 58162818 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 5,8-dimethylimidazo[1,2-f]phenanthridine |
| SMILES | Cc1ccc(C)c2c1c1ccccc1c1nccn12 |
| InChI | InChI=1S/C17H14N2/c1-11-7-8-12(2)16-15(11)13-5-3-4-6-14(13)17-18-9-10-19(16)17/h3-10H,1-2H3 |
| InChIKey | JDSZHNHSSLHOQT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dimethylimidazo[1,2-f]phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethylimidazo[1,2-f]phenanthridine?
The IUPAC name of 5,8-dimethylimidazo[1,2-f]phenanthridine (CID 58162818) is 5,8-dimethylimidazo[1,2-f]phenanthridine.
What is the SMILES notation for 5,8-dimethylimidazo[1,2-f]phenanthridine?
The canonical SMILES for 5,8-dimethylimidazo[1,2-f]phenanthridine is Cc1ccc(C)c2c1c1ccccc1c1nccn12.
What is the InChIKey of 5,8-dimethylimidazo[1,2-f]phenanthridine?
The InChIKey is JDSZHNHSSLHOQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2/c1-11-7-8-12(2)16-15(11)13-5-3-4-6-14(13)17-18-9-10-19(16)17/h3-10H,1-2H3.
What are the key properties of 5,8-dimethylimidazo[1,2-f]phenanthridine?
5,8-dimethylimidazo[1,2-f]phenanthridine has a molecular weight of 246.31 g/mol, XLogP of 4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethylimidazo[1,2-f]phenanthridine is sourced from PubChem (CID 58162818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).