C34H30IrN6-2 — CID 58162995
2-(5-tert-butyl-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl)pyridine;5-(2,6-dimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 58162995) has the molecular formula C34H30IrN6-2 and a molecular weight of 714.87 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl)pyridine;5-(2,6-dimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 2-(5-tert-butyl-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl)pyridine;5-(2,6-dimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 58162995 |
| Molecular Formula | C34H30IrN6-2 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 715.22 |
| IUPAC Name | 2-(5-tert-butyl-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl)pyridine;5-(2,6-dimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | CC(C)(C)c1n[n-]c(-c2ccccn2)n1.Cc1cccc(C)c1-c1cccc2c3ccc[c-]c3c3nccn3c12.[Ir] |
| InChI | InChI=1S/C23H17N2.C11H13N4.Ir/c1-15-7-5-8-16(2)21(15)20-12-6-11-18-17-9-3-4-10-19(17)23-24-13-14-25(23)22(18)20;1-11(2,3)10-13-9(14-15-10)8-6-4-5-7-12-8;/h3-9,11-14H,1-2H3;4-7H,1-3H3;/q2*-1; |
| InChIKey | MDBQCVMNUDFARP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 70.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|