About tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane
tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane (PubChem CID 58163083) has the molecular formula C29H40N2Sn
and a molecular weight of 535.36 g/mol. Its IUPAC name is tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane |
| PubChem CID | 58163083 |
| Molecular Formula | C29H40N2Sn |
| Molecular Weight | 535.36 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc2c3cc(C)c(C)cc3n3ccnc3c12 |
| InChI | InChI=1S/C17H13N2.3C4H9.Sn/c1-11-9-15-13-5-3-4-6-14(13)17-18-7-8-19(17)16(15)10-12(11)2;3*1-3-4-2;/h3-5,7-10H,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | PESRYMCLFGWGLW-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.36 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane?
The IUPAC name of tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane (CID 58163083) is tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane.
What is the SMILES notation for tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane?
The canonical SMILES for tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1cccc2c3cc(C)c(C)cc3n3ccnc3c12.
What is the InChIKey of tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane?
The InChIKey is PESRYMCLFGWGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N2.3C4H9.Sn/c1-11-9-15-13-5-3-4-6-14(13)17-18-7-8-19(17)16(15)10-12(11)2;3*1-3-4-2;/h3-5,7-10H,1-2H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane?
tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane has a molecular weight of 535.36 g/mol, XLogP of 8.31, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(6,7-dimethylimidazo[1,2-f]phenanthridin-12-yl)stannane is sourced from PubChem (CID 58163083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).