About 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine
5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine (PubChem CID 58163128) has the molecular formula C19H12N4
and a molecular weight of 296.33 g/mol. Its IUPAC name is 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine.
Molecular Properties
| Compound Name | 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine |
| PubChem CID | 58163128 |
| Molecular Formula | C19H12N4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine |
| SMILES | c1ccc2c(c1)c1cccc(-c3cncnc3)c1n1ccnc21 |
| InChI | InChI=1S/C19H12N4/c1-2-5-17-15(4-1)16-7-3-6-14(13-10-20-12-21-11-13)18(16)23-9-8-22-19(17)23/h1-12H |
| InChIKey | KCPRRYXPYSZJQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine?
The IUPAC name of 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine (CID 58163128) is 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine.
What is the SMILES notation for 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine?
The canonical SMILES for 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine is c1ccc2c(c1)c1cccc(-c3cncnc3)c1n1ccnc21.
What is the InChIKey of 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine?
The InChIKey is KCPRRYXPYSZJQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N4/c1-2-5-17-15(4-1)16-7-3-6-14(13-10-20-12-21-11-13)18(16)23-9-8-22-19(17)23/h1-12H.
What are the key properties of 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine?
5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine has a molecular weight of 296.33 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrimidin-5-ylimidazo[1,2-f]phenanthridine is sourced from PubChem (CID 58163128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).