About iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine
iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine (PubChem CID 58163132) has the molecular formula C25H15F3IrN2S-2
and a molecular weight of 624.69 g/mol. Its IUPAC name is iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
Molecular Properties
| Compound Name | iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| PubChem CID | 58163132 |
| Molecular Formula | C25H15F3IrN2S-2 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| SMILES | FC(F)(F)c1cc[c-]c(-c2ccccn2)c1.[Ir].[c-]1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H8NS.C12H7F3N.Ir/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;13-12(14,15)10-5-3-4-9(8-10)11-6-1-2-7-16-11;/h1-6,8-9H;1-3,5-8H;/q2*-1; |
| InChIKey | UOXWMHUXIKJXNC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The IUPAC name of iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine (CID 58163132) is iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
What is the SMILES notation for iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The canonical SMILES for iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine is FC(F)(F)c1cc[c-]c(-c2ccccn2)c1.[Ir].[c-]1ccccc1-c1nc2ccccc2s1.
What is the InChIKey of iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The InChIKey is UOXWMHUXIKJXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8NS.C12H7F3N.Ir/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;13-12(14,15)10-5-3-4-9(8-10)11-6-1-2-7-16-11;/h1-6,8-9H;1-3,5-8H;/q2*-1;.
What are the key properties of iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine has a molecular weight of 624.69 g/mol, XLogP of 7.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-phenyl-1,3-benzothiazole;2-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridine is sourced from PubChem (CID 58163132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).