C17H12 — CID 58163483
14-methylhexadeca-2,4,6,8,10,12-hexayne (PubChem CID 58163483) has the molecular formula C17H12 and a molecular weight of 216.28 g/mol. Its IUPAC name is 14-methylhexadeca-2,4,6,8,10,12-hexayne.
| Compound Name | 14-methylhexadeca-2,4,6,8,10,12-hexayne |
|---|---|
| PubChem CID | 58163483 |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 14-methylhexadeca-2,4,6,8,10,12-hexayne |
| SMILES | CC#CC#CC#CC#CC#CC#CC(C)CC |
| InChI | InChI=1S/C17H12/c1-4-6-7-8-9-10-11-12-13-14-15-16-17(3)5-2/h17H,5H2,1-3H3 |
| InChIKey | MSTADDSBDQEJMW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|