About 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate
3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate (PubChem CID 58163588) has the molecular formula C21H39NO2
and a molecular weight of 337.55 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate |
| PubChem CID | 58163588 |
| Molecular Formula | C21H39NO2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.30 |
| IUPAC Name | 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate |
| SMILES | CN(C)CCCOC(=O)CCCCCCCCCC[C@H]1C=CCC1 |
| InChI | InChI=1S/C21H39NO2/c1-22(2)18-13-19-24-21(23)17-10-8-6-4-3-5-7-9-14-20-15-11-12-16-20/h11,15,20H,3-10,12-14,16-19H2,1-2H3/t20-/m0/s1 |
| InChIKey | HIQZERBOHWKVCM-FQEVSTJZSA-N |
| XLogP | 5.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate?
The IUPAC name of 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate (CID 58163588) is 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate.
What is the SMILES notation for 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate?
The canonical SMILES for 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate is CN(C)CCCOC(=O)CCCCCCCCCC[C@H]1C=CCC1.
What is the InChIKey of 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate?
The InChIKey is HIQZERBOHWKVCM-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H39NO2/c1-22(2)18-13-19-24-21(23)17-10-8-6-4-3-5-7-9-14-20-15-11-12-16-20/h11,15,20H,3-10,12-14,16-19H2,1-2H3/t20-/m0/s1.
What are the key properties of 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate?
3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate has a molecular weight of 337.55 g/mol, XLogP of 5.35, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 11-[(1R)-cyclopent-2-en-1-yl]undecanoate is sourced from PubChem (CID 58163588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).