C25H22N6O2S — CID 58163710
N-(2-aminophenyl)-4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 58163710) has the molecular formula C25H22N6O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 58163710 |
| Molecular Formula | C25H22N6O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-(8-methoxy-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | COc1cccn2c(-c3csc(Nc4ccc(C(=O)Nc5ccccc5N)cc4)n3)c(C)nc12 |
| InChI | InChI=1S/C25H22N6O2S/c1-15-22(31-13-5-8-21(33-2)23(31)27-15)20-14-34-25(30-20)28-17-11-9-16(10-12-17)24(32)29-19-7-4-3-6-18(19)26/h3-14H,26H2,1-2H3,(H,28,30)(H,29,32) |
| InChIKey | MNCVHVXHJCNDSU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|