C27H26N6O3S — CID 58163867
N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 58163867) has the molecular formula C27H26N6O3S and a molecular weight of 514.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 58163867 |
| Molecular Formula | C27H26N6O3S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | COCCOc1ccc2nc(C)c(-c3csc(Nc4ccc(C(=O)Nc5ccccc5N)cc4)n3)n2c1 |
| InChI | InChI=1S/C27H26N6O3S/c1-17-25(33-15-20(36-14-13-35-2)11-12-24(33)29-17)23-16-37-27(32-23)30-19-9-7-18(8-10-19)26(34)31-22-6-4-3-5-21(22)28/h3-12,15-16H,13-14,28H2,1-2H3,(H,30,32)(H,31,34) |
| InChIKey | JMDSGZBGZRYYGN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|