About 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole
2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole (PubChem CID 58164370) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole |
| PubChem CID | 58164370 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole |
| SMILES | c1ccc2c(c1)CC(c1nc3ccc(-c4cn[nH]c4)cc3[nH]1)O2 |
| InChI | InChI=1S/C18H14N4O/c1-2-4-16-12(3-1)8-17(23-16)18-21-14-6-5-11(7-15(14)22-18)13-9-19-20-10-13/h1-7,9-10,17H,8H2,(H,19,20)(H,21,22) |
| InChIKey | MDMBYFMIJYNLLC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole?
The IUPAC name of 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole (CID 58164370) is 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole.
What is the SMILES notation for 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole?
The canonical SMILES for 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole is c1ccc2c(c1)CC(c1nc3ccc(-c4cn[nH]c4)cc3[nH]1)O2.
What is the InChIKey of 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole?
The InChIKey is MDMBYFMIJYNLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O/c1-2-4-16-12(3-1)8-17(23-16)18-21-14-6-5-11(7-15(14)22-18)13-9-19-20-10-13/h1-7,9-10,17H,8H2,(H,19,20)(H,21,22).
What are the key properties of 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole?
2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole has a molecular weight of 302.34 g/mol, XLogP of 3.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1-benzofuran-2-yl)-6-(1H-pyrazol-4-yl)-1H-benzimidazole is sourced from PubChem (CID 58164370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).