C13H23N — CID 58164588
2,3,5-tri(propan-2-yl)-3H-pyrrole (PubChem CID 58164588) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,3,5-tri(propan-2-yl)-3H-pyrrole.
| Compound Name | 2,3,5-tri(propan-2-yl)-3H-pyrrole |
|---|---|
| PubChem CID | 58164588 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,3,5-tri(propan-2-yl)-3H-pyrrole |
| SMILES | CC(C)C1=CC(C(C)C)C(C(C)C)=N1 |
| InChI | InChI=1S/C13H23N/c1-8(2)11-7-12(9(3)4)14-13(11)10(5)6/h7-11H,1-6H3 |
| InChIKey | ZSAAXPAAKWSPDB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |