C23H16F2IN3OS — CID 58164650
2-(2,6-difluoro-3-iodophenyl)-1-(13-imidazol-1-yl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone (PubChem CID 58164650) has the molecular formula C23H16F2IN3OS and a molecular weight of 547.37 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-iodophenyl)-1-(13-imidazol-1-yl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone.
| Compound Name | 2-(2,6-difluoro-3-iodophenyl)-1-(13-imidazol-1-yl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone |
|---|---|
| PubChem CID | 58164650 |
| Molecular Formula | C23H16F2IN3OS |
| Molecular Weight | 547.37 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | 2-(2,6-difluoro-3-iodophenyl)-1-(13-imidazol-1-yl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone |
| SMILES | O=C(Cc1c(F)ccc(I)c1F)c1nc2c(s1)-c1cc(-n3ccnc3)ccc1CCC2 |
| InChI | InChI=1S/C23H16F2IN3OS/c24-17-6-7-18(26)21(25)16(17)11-20(30)23-28-19-3-1-2-13-4-5-14(29-9-8-27-12-29)10-15(13)22(19)31-23/h4-10,12H,1-3,11H2 |
| InChIKey | RHCZFGXSKZRVRT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|