C24H22F2N4OS — CID 58164720
1-(2,4-difluorophenyl)-2-[14-(4-methyl-1,3-thiazol-2-yl)-3,6,14-triazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6-tetraen-5-yl]ethanone (PubChem CID 58164720) has the molecular formula C24H22F2N4OS and a molecular weight of 452.53 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-[14-(4-methyl-1,3-thiazol-2-yl)-3,6,14-triazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6-tetraen-5-yl]ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-[14-(4-methyl-1,3-thiazol-2-yl)-3,6,14-triazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6-tetraen-5-yl]ethanone |
|---|---|
| PubChem CID | 58164720 |
| Molecular Formula | C24H22F2N4OS |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-[14-(4-methyl-1,3-thiazol-2-yl)-3,6,14-triazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6-tetraen-5-yl]ethanone |
| SMILES | Cc1csc(N2CCC3=C(C2)c2ncc(CC(=O)c4ccc(F)cc4F)nc2CCC3)n1 |
| InChI | InChI=1S/C24H22F2N4OS/c1-14-13-32-24(28-14)30-8-7-15-3-2-4-21-23(19(15)12-30)27-11-17(29-21)10-22(31)18-6-5-16(25)9-20(18)26/h5-6,9,11,13H,2-4,7-8,10,12H2,1H3 |
| InChIKey | SPKWIZQICOMMFN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |