C26H21F2N3O — CID 58164857
1-(2,6-difluorophenyl)-2-[14-(1-methylimidazol-2-yl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-5-yl]ethanone (PubChem CID 58164857) has the molecular formula C26H21F2N3O and a molecular weight of 429.47 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[14-(1-methylimidazol-2-yl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-5-yl]ethanone.
| Compound Name | 1-(2,6-difluorophenyl)-2-[14-(1-methylimidazol-2-yl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-5-yl]ethanone |
|---|---|
| PubChem CID | 58164857 |
| Molecular Formula | C26H21F2N3O |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[14-(1-methylimidazol-2-yl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-5-yl]ethanone |
| SMILES | Cn1ccnc1-c1ccc2c(c1)-c1ncc(CC(=O)c3c(F)cccc3F)cc1CCC2 |
| InChI | InChI=1S/C26H21F2N3O/c1-31-11-10-29-26(31)19-9-8-17-4-2-5-18-12-16(15-30-25(18)20(17)14-19)13-23(32)24-21(27)6-3-7-22(24)28/h3,6-12,14-15H,2,4-5,13H2,1H3 |
| InChIKey | YQBRARFEONGYDE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |